C18H32N4S2 — CID 111629228
1-ethyl-3-(4-methylsulfanylbutyl)-2-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine (PubChem CID 111629228) has the molecular formula C18H32N4S2 and a molecular weight of 368.62 g/mol. Its IUPAC name is 1-ethyl-3-(4-methylsulfanylbutyl)-2-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-ethyl-3-(4-methylsulfanylbutyl)-2-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111629228 |
| Molecular Formula | C18H32N4S2 |
| Molecular Weight | 368.62 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 1-ethyl-3-(4-methylsulfanylbutyl)-2-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine |
| SMILES | CCN/C(=N\CC(c1cccs1)N1CCCC1)NCCCCSC |
| InChI | InChI=1S/C18H32N4S2/c1-3-19-18(20-10-4-7-13-23-2)21-15-16(17-9-8-14-24-17)22-11-5-6-12-22/h8-9,14,16H,3-7,10-13,15H2,1-2H3,(H2,19,20,21) |
| InChIKey | TZBYBLJDBXRDLP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.62 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|