C22H34N6S — CID 111012481
1-ethyl-3-[4-(pyridin-2-ylamino)butyl]-2-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine (PubChem CID 111012481) has the molecular formula C22H34N6S and a molecular weight of 414.62 g/mol. Its IUPAC name is 1-ethyl-3-[4-(pyridin-2-ylamino)butyl]-2-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-ethyl-3-[4-(pyridin-2-ylamino)butyl]-2-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111012481 |
| Molecular Formula | C22H34N6S |
| Molecular Weight | 414.62 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | 1-ethyl-3-[4-(pyridin-2-ylamino)butyl]-2-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine |
| SMILES | CCN/C(=N\CC(c1cccs1)N1CCCC1)NCCCCNc1ccccn1 |
| InChI | InChI=1S/C22H34N6S/c1-2-23-22(26-14-6-5-13-25-21-11-3-4-12-24-21)27-18-19(20-10-9-17-29-20)28-15-7-8-16-28/h3-4,9-12,17,19H,2,5-8,13-16,18H2,1H3,(H,24,25)(H2,23,26,27) |
| InChIKey | CJHDIOXAHSXXAG-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 64.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.62 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|