C17H31N5O2S2 — CID 111011911
1-ethyl-3-[3-(methanesulfonamido)propyl]-2-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine (PubChem CID 111011911) has the molecular formula C17H31N5O2S2 and a molecular weight of 401.60 g/mol. Its IUPAC name is 1-ethyl-3-[3-(methanesulfonamido)propyl]-2-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-ethyl-3-[3-(methanesulfonamido)propyl]-2-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111011911 |
| Molecular Formula | C17H31N5O2S2 |
| Molecular Weight | 401.60 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 1-ethyl-3-[3-(methanesulfonamido)propyl]-2-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine |
| SMILES | CCN/C(=N\CC(c1cccs1)N1CCCC1)NCCCNS(C)(=O)=O |
| InChI | InChI=1S/C17H31N5O2S2/c1-3-18-17(19-9-7-10-21-26(2,23)24)20-14-15(16-8-6-13-25-16)22-11-4-5-12-22/h6,8,13,15,21H,3-5,7,9-12,14H2,1-2H3,(H2,18,19,20) |
| InChIKey | PYCQVZONTQPRAF-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.60 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|