C25H39IN6O — CID 111322301
1-ethyl-2-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-3-[4-(pyridin-2-ylamino)butyl]guanidine;hydroiodide (PubChem CID 111322301) has the molecular formula C25H39IN6O and a molecular weight of 566.53 g/mol. Its IUPAC name is 1-ethyl-2-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-3-[4-(pyridin-2-ylamino)butyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-3-[4-(pyridin-2-ylamino)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111322301 |
| Molecular Formula | C25H39IN6O |
| Molecular Weight | 566.53 g/mol |
| Exact Mass | 566.22 |
| IUPAC Name | 1-ethyl-2-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-3-[4-(pyridin-2-ylamino)butyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(c1ccccc1OC)N1CCCC1)NCCCCNc1ccccn1.I |
| InChI | InChI=1S/C25H38N6O.HI/c1-3-26-25(29-17-9-8-16-28-24-14-6-7-15-27-24)30-20-22(31-18-10-11-19-31)21-12-4-5-13-23(21)32-2;/h4-7,12-15,22H,3,8-11,16-20H2,1-2H3,(H,27,28)(H2,26,29,30);1H |
| InChIKey | CNVBLPJCJFYRGW-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.53 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|