C23H36IN5O2 — CID 111765676
1-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-3-ethyl-2-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]guanidine;hydroiodide (PubChem CID 111765676) has the molecular formula C23H36IN5O2 and a molecular weight of 541.48 g/mol. Its IUPAC name is 1-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-3-ethyl-2-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-3-ethyl-2-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111765676 |
| Molecular Formula | C23H36IN5O2 |
| Molecular Weight | 541.48 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | 1-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-3-ethyl-2-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(c1ccccc1OC)N1CCCC1)NCCc1c(C)noc1C.I |
| InChI | InChI=1S/C23H35N5O2.HI/c1-5-24-23(25-13-12-19-17(2)27-30-18(19)3)26-16-21(28-14-8-9-15-28)20-10-6-7-11-22(20)29-4;/h6-7,10-11,21H,5,8-9,12-16H2,1-4H3,(H2,24,25,26);1H |
| InChIKey | LVZUANICDDKGFR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 74.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|