C23H39N5O — CID 111322832
1-ethyl-2-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-3-(3-pyrrolidin-1-ylpropyl)guanidine (PubChem CID 111322832) has the molecular formula C23H39N5O and a molecular weight of 401.60 g/mol. Its IUPAC name is 1-ethyl-2-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-3-(3-pyrrolidin-1-ylpropyl)guanidine.
| Compound Name | 1-ethyl-2-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-3-(3-pyrrolidin-1-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111322832 |
| Molecular Formula | C23H39N5O |
| Molecular Weight | 401.60 g/mol |
| Exact Mass | 401.32 |
| IUPAC Name | 1-ethyl-2-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-3-(3-pyrrolidin-1-ylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(c1ccccc1OC)N1CCCC1)NCCCN1CCCC1 |
| InChI | InChI=1S/C23H39N5O/c1-3-24-23(25-13-10-16-27-14-6-7-15-27)26-19-21(28-17-8-9-18-28)20-11-4-5-12-22(20)29-2/h4-5,11-12,21H,3,6-10,13-19H2,1-2H3,(H2,24,25,26) |
| InChIKey | HSXQBPXGWJRGNY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.60 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|