C21H36N4O4S — CID 111515859
1-ethyl-2-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine (PubChem CID 111515859) has the molecular formula C21H36N4O4S and a molecular weight of 440.61 g/mol. Its IUPAC name is 1-ethyl-2-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine.
| Compound Name | 1-ethyl-2-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine |
|---|---|
| PubChem CID | 111515859 |
| Molecular Formula | C21H36N4O4S |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | 1-ethyl-2-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine |
| SMILES | CCN/C(=N\CC(c1ccccc1OC)N1CCCC1)NCCOCCS(C)(=O)=O |
| InChI | InChI=1S/C21H36N4O4S/c1-4-22-21(23-11-14-29-15-16-30(3,26)27)24-17-19(25-12-7-8-13-25)18-9-5-6-10-20(18)28-2/h5-6,9-10,19H,4,7-8,11-17H2,1-3H3,(H2,22,23,24) |
| InChIKey | PZQACIYFBNBBLY-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|