C22H39IN4O2S — CID 111642667
2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-1-ethyl-3-[3-(oxan-4-ylmethoxy)propyl]guanidine;hydroiodide (PubChem CID 111642667) has the molecular formula C22H39IN4O2S and a molecular weight of 550.55 g/mol. Its IUPAC name is 2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-1-ethyl-3-[3-(oxan-4-ylmethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-1-ethyl-3-[3-(oxan-4-ylmethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111642667 |
| Molecular Formula | C22H39IN4O2S |
| Molecular Weight | 550.55 g/mol |
| Exact Mass | 550.18 |
| IUPAC Name | 2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-1-ethyl-3-[3-(oxan-4-ylmethoxy)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)N1CCc2sccc2C1)NCCCOCC1CCOCC1.I |
| InChI | InChI=1S/C22H38N4O2S.HI/c1-3-23-22(24-9-4-11-28-17-19-6-12-27-13-7-19)25-15-18(2)26-10-5-21-20(16-26)8-14-29-21;/h8,14,18-19H,3-7,9-13,15-17H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | LGSZYXJGJSKYGI-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.55 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|