C21H37IN4O2S — CID 111745714
N'-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-N-ethyl-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111745714) has the molecular formula C21H37IN4O2S and a molecular weight of 536.52 g/mol. Its IUPAC name is N'-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-N-ethyl-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-N-ethyl-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111745714 |
| Molecular Formula | C21H37IN4O2S |
| Molecular Weight | 536.52 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | N'-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-N-ethyl-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC(C)N1CCc2sccc2C1)N1CCC(COCCOC)C1.I |
| InChI | InChI=1S/C21H36N4O2S.HI/c1-4-22-21(25-8-5-18(14-25)16-27-11-10-26-3)23-13-17(2)24-9-6-20-19(15-24)7-12-28-20;/h7,12,17-18H,4-6,8-11,13-16H2,1-3H3,(H,22,23);1H |
| InChIKey | ICUAJSGPJDFOGP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.52 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|