C20H34N4O2S — CID 111745517
N-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-3-(2-methoxyethoxymethyl)-N'-methylpyrrolidine-1-carboximidamide (PubChem CID 111745517) has the molecular formula C20H34N4O2S and a molecular weight of 394.59 g/mol. Its IUPAC name is N-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-3-(2-methoxyethoxymethyl)-N'-methylpyrrolidine-1-carboximidamide.
| Compound Name | N-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-3-(2-methoxyethoxymethyl)-N'-methylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111745517 |
| Molecular Formula | C20H34N4O2S |
| Molecular Weight | 394.59 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | N-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-3-(2-methoxyethoxymethyl)-N'-methylpyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCC(C)N1CCc2sccc2C1)N1CCC(COCCOC)C1 |
| InChI | InChI=1S/C20H34N4O2S/c1-16(23-8-5-19-18(14-23)6-11-27-19)12-22-20(21-2)24-7-4-17(13-24)15-26-10-9-25-3/h6,11,16-17H,4-5,7-10,12-15H2,1-3H3,(H,21,22) |
| InChIKey | TVNLVSKNGQVFKQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.59 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|