C16H23N3O — CID 75515058
N'-[(2-methyl-1,3-dihydroinden-2-yl)methyl]morpholine-4-carboximidamide (PubChem CID 75515058) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is N'-[(2-methyl-1,3-dihydroinden-2-yl)methyl]morpholine-4-carboximidamide.
| Compound Name | N'-[(2-methyl-1,3-dihydroinden-2-yl)methyl]morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 75515058 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | N'-[(2-methyl-1,3-dihydroinden-2-yl)methyl]morpholine-4-carboximidamide |
| SMILES | CC1(C/N=C(\N)N2CCOCC2)Cc2ccccc2C1 |
| InChI | InChI=1S/C16H23N3O/c1-16(10-13-4-2-3-5-14(13)11-16)12-18-15(17)19-6-8-20-9-7-19/h2-5H,6-12H2,1H3,(H2,17,18) |
| InChIKey | ZAFXSHHGNURXGH-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|