About N'-[(2-methyl-1,3-dihydroinden-2-yl)methyl]morpholine-4-carboximidamide
N'-[(2-methyl-1,3-dihydroinden-2-yl)methyl]morpholine-4-carboximidamide (PubChem CID 75515058) has the molecular formula C16H23N3O
and a molecular weight of 273.38 g/mol. Its IUPAC name is N'-[(2-methyl-1,3-dihydroinden-2-yl)methyl]morpholine-4-carboximidamide.
Molecular Properties
| Compound Name | N'-[(2-methyl-1,3-dihydroinden-2-yl)methyl]morpholine-4-carboximidamide |
| PubChem CID | 75515058 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | N'-[(2-methyl-1,3-dihydroinden-2-yl)methyl]morpholine-4-carboximidamide |
| SMILES | CC1(C/N=C(\N)N2CCOCC2)Cc2ccccc2C1 |
| InChI | InChI=1S/C16H23N3O/c1-16(10-13-4-2-3-5-14(13)11-16)12-18-15(17)19-6-8-20-9-7-19/h2-5H,6-12H2,1H3,(H2,17,18) |
| InChIKey | ZAFXSHHGNURXGH-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[(2-methyl-1,3-dihydroinden-2-yl)methyl]morpholine-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(2-methyl-1,3-dihydroinden-2-yl)methyl]morpholine-4-carboximidamide?
The IUPAC name of N'-[(2-methyl-1,3-dihydroinden-2-yl)methyl]morpholine-4-carboximidamide (CID 75515058) is N'-[(2-methyl-1,3-dihydroinden-2-yl)methyl]morpholine-4-carboximidamide.
What is the SMILES notation for N'-[(2-methyl-1,3-dihydroinden-2-yl)methyl]morpholine-4-carboximidamide?
The canonical SMILES for N'-[(2-methyl-1,3-dihydroinden-2-yl)methyl]morpholine-4-carboximidamide is CC1(C/N=C(\N)N2CCOCC2)Cc2ccccc2C1.
What is the InChIKey of N'-[(2-methyl-1,3-dihydroinden-2-yl)methyl]morpholine-4-carboximidamide?
The InChIKey is ZAFXSHHGNURXGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3O/c1-16(10-13-4-2-3-5-14(13)11-16)12-18-15(17)19-6-8-20-9-7-19/h2-5H,6-12H2,1H3,(H2,17,18).
What are the key properties of N'-[(2-methyl-1,3-dihydroinden-2-yl)methyl]morpholine-4-carboximidamide?
N'-[(2-methyl-1,3-dihydroinden-2-yl)methyl]morpholine-4-carboximidamide has a molecular weight of 273.38 g/mol, XLogP of 1.44, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(2-methyl-1,3-dihydroinden-2-yl)methyl]morpholine-4-carboximidamide is sourced from PubChem (CID 75515058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).