C15H22IN3O — CID 111038801
N'-[(1-phenylcyclopropyl)methyl]morpholine-4-carboximidamide;hydroiodide (PubChem CID 111038801) has the molecular formula C15H22IN3O and a molecular weight of 387.27 g/mol. Its IUPAC name is N'-[(1-phenylcyclopropyl)methyl]morpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[(1-phenylcyclopropyl)methyl]morpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111038801 |
| Molecular Formula | C15H22IN3O |
| Molecular Weight | 387.27 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | N'-[(1-phenylcyclopropyl)methyl]morpholine-4-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\CC1(c2ccccc2)CC1)N1CCOCC1 |
| InChI | InChI=1S/C15H21N3O.HI/c16-14(18-8-10-19-11-9-18)17-12-15(6-7-15)13-4-2-1-3-5-13;/h1-5H,6-12H2,(H2,16,17);1H |
| InChIKey | OKOPZGDDFDLTAY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|