C18H27ClIN3O — CID 111805279
N'-[[4-(2-chlorophenyl)oxan-4-yl]methyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 111805279) has the molecular formula C18H27ClIN3O and a molecular weight of 463.79 g/mol. Its IUPAC name is N'-[[4-(2-chlorophenyl)oxan-4-yl]methyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[[4-(2-chlorophenyl)oxan-4-yl]methyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111805279 |
| Molecular Formula | C18H27ClIN3O |
| Molecular Weight | 463.79 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | N'-[[4-(2-chlorophenyl)oxan-4-yl]methyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\CC1(c2ccccc2Cl)CCOCC1)N1CCCCC1 |
| InChI | InChI=1S/C18H26ClN3O.HI/c19-16-7-3-2-6-15(16)18(8-12-23-13-9-18)14-21-17(20)22-10-4-1-5-11-22;/h2-3,6-7H,1,4-5,8-14H2,(H2,20,21);1H |
| InChIKey | NAAFDFGFIJIEJN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.79 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|