C18H26Cl2IN3O — CID 111081407
N'-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 111081407) has the molecular formula C18H26Cl2IN3O and a molecular weight of 498.24 g/mol. Its IUPAC name is N'-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111081407 |
| Molecular Formula | C18H26Cl2IN3O |
| Molecular Weight | 498.24 g/mol |
| Exact Mass | 497.05 |
| IUPAC Name | N'-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\CC1(c2ccc(Cl)cc2Cl)CCOCC1)N1CCCCC1 |
| InChI | InChI=1S/C18H25Cl2N3O.HI/c19-14-4-5-15(16(20)12-14)18(6-10-24-11-7-18)13-22-17(21)23-8-2-1-3-9-23;/h4-5,12H,1-3,6-11,13H2,(H2,21,22);1H |
| InChIKey | AZTYVTRVOGRBQU-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.24 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|