C22H33ClN4O3 — CID 111805246
tert-butyl 4-[N'-[[4-(2-chlorophenyl)oxan-4-yl]methyl]carbamimidoyl]piperazine-1-carboxylate (PubChem CID 111805246) has the molecular formula C22H33ClN4O3 and a molecular weight of 436.98 g/mol. Its IUPAC name is tert-butyl 4-[N'-[[4-(2-chlorophenyl)oxan-4-yl]methyl]carbamimidoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[N'-[[4-(2-chlorophenyl)oxan-4-yl]methyl]carbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111805246 |
| Molecular Formula | C22H33ClN4O3 |
| Molecular Weight | 436.98 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | tert-butyl 4-[N'-[[4-(2-chlorophenyl)oxan-4-yl]methyl]carbamimidoyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(/C(N)=N/CC2(c3ccccc3Cl)CCOCC2)CC1 |
| InChI | InChI=1S/C22H33ClN4O3/c1-21(2,3)30-20(28)27-12-10-26(11-13-27)19(24)25-16-22(8-14-29-15-9-22)17-6-4-5-7-18(17)23/h4-7H,8-16H2,1-3H3,(H2,24,25) |
| InChIKey | VYLMXFHUOLNVBY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.98 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|