C18H28ClIN4O3 — CID 111801073
tert-butyl 4-[N'-[2-(2-chlorophenyl)-2-hydroxyethyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111801073) has the molecular formula C18H28ClIN4O3 and a molecular weight of 510.80 g/mol. Its IUPAC name is tert-butyl 4-[N'-[2-(2-chlorophenyl)-2-hydroxyethyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 4-[N'-[2-(2-chlorophenyl)-2-hydroxyethyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111801073 |
| Molecular Formula | C18H28ClIN4O3 |
| Molecular Weight | 510.80 g/mol |
| Exact Mass | 510.09 |
| IUPAC Name | tert-butyl 4-[N'-[2-(2-chlorophenyl)-2-hydroxyethyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | CC(C)(C)OC(=O)N1CCN(/C(N)=N/CC(O)c2ccccc2Cl)CC1.I |
| InChI | InChI=1S/C18H27ClN4O3.HI/c1-18(2,3)26-17(25)23-10-8-22(9-11-23)16(20)21-12-15(24)13-6-4-5-7-14(13)19;/h4-7,15,24H,8-12H2,1-3H3,(H2,20,21);1H |
| InChIKey | POBLOJVRHSSFPM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.80 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|