C19H28F2N4O2 — CID 111807496
tert-butyl 4-[N'-[2-(2,4-difluorophenyl)propyl]carbamimidoyl]piperazine-1-carboxylate (PubChem CID 111807496) has the molecular formula C19H28F2N4O2 and a molecular weight of 382.46 g/mol. Its IUPAC name is tert-butyl 4-[N'-[2-(2,4-difluorophenyl)propyl]carbamimidoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[N'-[2-(2,4-difluorophenyl)propyl]carbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111807496 |
| Molecular Formula | C19H28F2N4O2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | tert-butyl 4-[N'-[2-(2,4-difluorophenyl)propyl]carbamimidoyl]piperazine-1-carboxylate |
| SMILES | CC(C/N=C(\N)N1CCN(C(=O)OC(C)(C)C)CC1)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H28F2N4O2/c1-13(15-6-5-14(20)11-16(15)21)12-23-17(22)24-7-9-25(10-8-24)18(26)27-19(2,3)4/h5-6,11,13H,7-10,12H2,1-4H3,(H2,22,23) |
| InChIKey | SVOUOVSFPJCQRK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 71.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|