C20H29FIN5O2 — CID 111802115
tert-butyl 4-[N'-[2-(5-fluoro-1H-indol-3-yl)ethyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111802115) has the molecular formula C20H29FIN5O2 and a molecular weight of 517.39 g/mol. Its IUPAC name is tert-butyl 4-[N'-[2-(5-fluoro-1H-indol-3-yl)ethyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 4-[N'-[2-(5-fluoro-1H-indol-3-yl)ethyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111802115 |
| Molecular Formula | C20H29FIN5O2 |
| Molecular Weight | 517.39 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | tert-butyl 4-[N'-[2-(5-fluoro-1H-indol-3-yl)ethyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | CC(C)(C)OC(=O)N1CCN(/C(N)=N/CCc2c[nH]c3ccc(F)cc23)CC1.I |
| InChI | InChI=1S/C20H28FN5O2.HI/c1-20(2,3)28-19(27)26-10-8-25(9-11-26)18(22)23-7-6-14-13-24-17-5-4-15(21)12-16(14)17;/h4-5,12-13,24H,6-11H2,1-3H3,(H2,22,23);1H |
| InChIKey | VWUVWZSOPZDNBY-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 86.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|