C18H25N3O3 — CID 145020472
tert-butyl 4-[(5-hydroxy-1H-indol-3-yl)methyl]piperazine-1-carboxylate (PubChem CID 145020472) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is tert-butyl 4-[(5-hydroxy-1H-indol-3-yl)methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(5-hydroxy-1H-indol-3-yl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 145020472 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | tert-butyl 4-[(5-hydroxy-1H-indol-3-yl)methyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2c[nH]c3ccc(O)cc23)CC1 |
| InChI | InChI=1S/C18H25N3O3/c1-18(2,3)24-17(23)21-8-6-20(7-9-21)12-13-11-19-16-5-4-14(22)10-15(13)16/h4-5,10-11,19,22H,6-9,12H2,1-3H3 |
| InChIKey | FLGYUCYRXJOGMX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 68.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |