C16H25N3O3 — CID 104933485
tert-butyl 4-[(5-amino-2-hydroxyphenyl)methyl]piperazine-1-carboxylate (PubChem CID 104933485) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is tert-butyl 4-[(5-amino-2-hydroxyphenyl)methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(5-amino-2-hydroxyphenyl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 104933485 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | tert-butyl 4-[(5-amino-2-hydroxyphenyl)methyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2cc(N)ccc2O)CC1 |
| InChI | InChI=1S/C16H25N3O3/c1-16(2,3)22-15(21)19-8-6-18(7-9-19)11-12-10-13(17)4-5-14(12)20/h4-5,10,20H,6-9,11,17H2,1-3H3 |
| InChIKey | YPZKWFZIGHTFMK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|