C16H22ClFN2O2 — CID 138608922
tert-butyl 4-[(4-chloro-2-fluorophenyl)methyl]piperazine-1-carboxylate (PubChem CID 138608922) has the molecular formula C16H22ClFN2O2 and a molecular weight of 328.81 g/mol. Its IUPAC name is tert-butyl 4-[(4-chloro-2-fluorophenyl)methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(4-chloro-2-fluorophenyl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 138608922 |
| Molecular Formula | C16H22ClFN2O2 |
| Molecular Weight | 328.81 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | tert-butyl 4-[(4-chloro-2-fluorophenyl)methyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2ccc(Cl)cc2F)CC1 |
| InChI | InChI=1S/C16H22ClFN2O2/c1-16(2,3)22-15(21)20-8-6-19(7-9-20)11-12-4-5-13(17)10-14(12)18/h4-5,10H,6-9,11H2,1-3H3 |
| InChIKey | RNKDGNLGPHWDMO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.81 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |