C16H21F3N2O2 — CID 90725156
tert-butyl 4-[(2,3,5-trifluorophenyl)methyl]piperazine-1-carboxylate (PubChem CID 90725156) has the molecular formula C16H21F3N2O2 and a molecular weight of 330.35 g/mol. Its IUPAC name is tert-butyl 4-[(2,3,5-trifluorophenyl)methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2,3,5-trifluorophenyl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 90725156 |
| Molecular Formula | C16H21F3N2O2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | tert-butyl 4-[(2,3,5-trifluorophenyl)methyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2cc(F)cc(F)c2F)CC1 |
| InChI | InChI=1S/C16H21F3N2O2/c1-16(2,3)23-15(22)21-6-4-20(5-7-21)10-11-8-12(17)9-13(18)14(11)19/h8-9H,4-7,10H2,1-3H3 |
| InChIKey | YQPQIQOBYUFNQB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|