C16H24FN3O2 — CID 104933477
tert-butyl 4-[(2-amino-5-fluorophenyl)methyl]piperazine-1-carboxylate (PubChem CID 104933477) has the molecular formula C16H24FN3O2 and a molecular weight of 309.38 g/mol. Its IUPAC name is tert-butyl 4-[(2-amino-5-fluorophenyl)methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2-amino-5-fluorophenyl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 104933477 |
| Molecular Formula | C16H24FN3O2 |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | tert-butyl 4-[(2-amino-5-fluorophenyl)methyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2cc(F)ccc2N)CC1 |
| InChI | InChI=1S/C16H24FN3O2/c1-16(2,3)22-15(21)20-8-6-19(7-9-20)11-12-10-13(17)4-5-14(12)18/h4-5,10H,6-9,11,18H2,1-3H3 |
| InChIKey | NDNKJOROCUSXGA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|