C18H28ClN3O2 — CID 137383819
tert-butyl 4-[[5-chloro-2-methyl-3-(methylamino)phenyl]methyl]piperazine-1-carboxylate (PubChem CID 137383819) has the molecular formula C18H28ClN3O2 and a molecular weight of 353.89 g/mol. Its IUPAC name is tert-butyl 4-[[5-chloro-2-methyl-3-(methylamino)phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[5-chloro-2-methyl-3-(methylamino)phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 137383819 |
| Molecular Formula | C18H28ClN3O2 |
| Molecular Weight | 353.89 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | tert-butyl 4-[[5-chloro-2-methyl-3-(methylamino)phenyl]methyl]piperazine-1-carboxylate |
| SMILES | CNc1cc(Cl)cc(CN2CCN(C(=O)OC(C)(C)C)CC2)c1C |
| InChI | InChI=1S/C18H28ClN3O2/c1-13-14(10-15(19)11-16(13)20-5)12-21-6-8-22(9-7-21)17(23)24-18(2,3)4/h10-11,20H,6-9,12H2,1-5H3 |
| InChIKey | MFVXOHBBKLRRAW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.89 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |