C23H39N3O2 — CID 134507804
tert-butyl 4-[[2-(hexylamino)-4-methylphenyl]methyl]piperazine-1-carboxylate (PubChem CID 134507804) has the molecular formula C23H39N3O2 and a molecular weight of 389.58 g/mol. Its IUPAC name is tert-butyl 4-[[2-(hexylamino)-4-methylphenyl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-(hexylamino)-4-methylphenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 134507804 |
| Molecular Formula | C23H39N3O2 |
| Molecular Weight | 389.58 g/mol |
| Exact Mass | 389.30 |
| IUPAC Name | tert-butyl 4-[[2-(hexylamino)-4-methylphenyl]methyl]piperazine-1-carboxylate |
| SMILES | CCCCCCNc1cc(C)ccc1CN1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C23H39N3O2/c1-6-7-8-9-12-24-21-17-19(2)10-11-20(21)18-25-13-15-26(16-14-25)22(27)28-23(3,4)5/h10-11,17,24H,6-9,12-16,18H2,1-5H3 |
| InChIKey | IVHNEKXNMPSLDY-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.58 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|