C23H37N3O3 — CID 159125056
tert-butyl 4-[[2-(4-methoxypiperidin-1-yl)-4-methylphenyl]methyl]piperazine-1-carboxylate (PubChem CID 159125056) has the molecular formula C23H37N3O3 and a molecular weight of 403.57 g/mol. Its IUPAC name is tert-butyl 4-[[2-(4-methoxypiperidin-1-yl)-4-methylphenyl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-(4-methoxypiperidin-1-yl)-4-methylphenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 159125056 |
| Molecular Formula | C23H37N3O3 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.28 |
| IUPAC Name | tert-butyl 4-[[2-(4-methoxypiperidin-1-yl)-4-methylphenyl]methyl]piperazine-1-carboxylate |
| SMILES | COC1CCN(c2cc(C)ccc2CN2CCN(C(=O)OC(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C23H37N3O3/c1-18-6-7-19(21(16-18)25-10-8-20(28-5)9-11-25)17-24-12-14-26(15-13-24)22(27)29-23(2,3)4/h6-7,16,20H,8-15,17H2,1-5H3 |
| InChIKey | PVWCEQGRVJPBRC-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |