C24H32F6N4O3 — CID 122549383
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-[4-(dimethylcarbamoyl)piperidin-1-yl]-4-methylphenyl]methyl]piperazine-1-carboxylate (PubChem CID 122549383) has the molecular formula C24H32F6N4O3 and a molecular weight of 538.53 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-[4-(dimethylcarbamoyl)piperidin-1-yl]-4-methylphenyl]methyl]piperazine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-[4-(dimethylcarbamoyl)piperidin-1-yl]-4-methylphenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 122549383 |
| Molecular Formula | C24H32F6N4O3 |
| Molecular Weight | 538.53 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-[4-(dimethylcarbamoyl)piperidin-1-yl]-4-methylphenyl]methyl]piperazine-1-carboxylate |
| SMILES | Cc1ccc(CN2CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC2)c(N2CCC(C(=O)N(C)C)CC2)c1 |
| InChI | InChI=1S/C24H32F6N4O3/c1-16-4-5-18(19(14-16)33-8-6-17(7-9-33)20(35)31(2)3)15-32-10-12-34(13-11-32)22(36)37-21(23(25,26)27)24(28,29)30/h4-5,14,17,21H,6-13,15H2,1-3H3 |
| InChIKey | VPXZRRVIXSRCKL-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 56.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.53 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |