C21H25F6N3O5 — CID 122549421
4-[2-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-5-methylphenyl]morpholine-3-carboxylic acid (PubChem CID 122549421) has the molecular formula C21H25F6N3O5 and a molecular weight of 513.44 g/mol. Its IUPAC name is 4-[2-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-5-methylphenyl]morpholine-3-carboxylic acid.
| Compound Name | 4-[2-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-5-methylphenyl]morpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 122549421 |
| Molecular Formula | C21H25F6N3O5 |
| Molecular Weight | 513.44 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | 4-[2-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-5-methylphenyl]morpholine-3-carboxylic acid |
| SMILES | Cc1ccc(CN2CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC2)c(N2CCOCC2C(=O)O)c1 |
| InChI | InChI=1S/C21H25F6N3O5/c1-13-2-3-14(15(10-13)30-8-9-34-12-16(30)17(31)32)11-28-4-6-29(7-5-28)19(33)35-18(20(22,23)24)21(25,26)27/h2-3,10,16,18H,4-9,11-12H2,1H3,(H,31,32) |
| InChIKey | QAQOESXXPCLVFW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |