C20H25F6N3O4 — CID 71657184
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(2-methoxy-4-morpholin-4-ylphenyl)methyl]piperazine-1-carboxylate (PubChem CID 71657184) has the molecular formula C20H25F6N3O4 and a molecular weight of 485.43 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(2-methoxy-4-morpholin-4-ylphenyl)methyl]piperazine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(2-methoxy-4-morpholin-4-ylphenyl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 71657184 |
| Molecular Formula | C20H25F6N3O4 |
| Molecular Weight | 485.43 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(2-methoxy-4-morpholin-4-ylphenyl)methyl]piperazine-1-carboxylate |
| SMILES | COc1cc(N2CCOCC2)ccc1CN1CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C20H25F6N3O4/c1-31-16-12-15(28-8-10-32-11-9-28)3-2-14(16)13-27-4-6-29(7-5-27)18(30)33-17(19(21,22)23)20(24,25)26/h2-3,12,17H,4-11,13H2,1H3 |
| InChIKey | SSXRFRFEEBHRFS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 54.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|