C25H29F6N3O3 — CID 163950952
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(4-cyclohexa-1,3-dien-1-yl-2-morpholin-4-ylphenyl)methyl]piperazine-1-carboxylate (PubChem CID 163950952) has the molecular formula C25H29F6N3O3 and a molecular weight of 533.51 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(4-cyclohexa-1,3-dien-1-yl-2-morpholin-4-ylphenyl)methyl]piperazine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(4-cyclohexa-1,3-dien-1-yl-2-morpholin-4-ylphenyl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 163950952 |
| Molecular Formula | C25H29F6N3O3 |
| Molecular Weight | 533.51 g/mol |
| Exact Mass | 533.21 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(4-cyclohexa-1,3-dien-1-yl-2-morpholin-4-ylphenyl)methyl]piperazine-1-carboxylate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)N1CCN(Cc2ccc(C3=CC=CCC3)cc2N2CCOCC2)CC1 |
| InChI | InChI=1S/C25H29F6N3O3/c26-24(27,28)22(25(29,30)31)37-23(35)34-10-8-32(9-11-34)17-20-7-6-19(18-4-2-1-3-5-18)16-21(20)33-12-14-36-15-13-33/h1-2,4,6-7,16,22H,3,5,8-15,17H2 |
| InChIKey | RZGLJXQKAQGYFY-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.51 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |