C21H23F10N3O2 — CID 122549668
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-[(3S)-3-(fluoromethyl)pyrrolidin-1-yl]-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate (PubChem CID 122549668) has the molecular formula C21H23F10N3O2 and a molecular weight of 539.41 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-[(3S)-3-(fluoromethyl)pyrrolidin-1-yl]-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-[(3S)-3-(fluoromethyl)pyrrolidin-1-yl]-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 122549668 |
| Molecular Formula | C21H23F10N3O2 |
| Molecular Weight | 539.41 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-[(3S)-3-(fluoromethyl)pyrrolidin-1-yl]-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)N1CCN(Cc2ccc(C(F)(F)F)cc2N2CC[C@H](CF)C2)CC1 |
| InChI | InChI=1S/C21H23F10N3O2/c22-10-13-3-4-34(11-13)16-9-15(19(23,24)25)2-1-14(16)12-32-5-7-33(8-6-32)18(35)36-17(20(26,27)28)21(29,30)31/h1-2,9,13,17H,3-8,10-12H2/t13-/m1/s1 |
| InChIKey | YMKSJBLDCDRDRR-CYBMUJFWSA-N |
| XLogP | 5.25 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.41 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |