C22H28F6N4O4 — CID 161060563
4-[2-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-5-methylphenyl]-1-methylpiperazine-2-carboxylic acid (PubChem CID 161060563) has the molecular formula C22H28F6N4O4 and a molecular weight of 526.48 g/mol. Its IUPAC name is 4-[2-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-5-methylphenyl]-1-methylpiperazine-2-carboxylic acid.
| Compound Name | 4-[2-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-5-methylphenyl]-1-methylpiperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 161060563 |
| Molecular Formula | C22H28F6N4O4 |
| Molecular Weight | 526.48 g/mol |
| Exact Mass | 526.20 |
| IUPAC Name | 4-[2-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-5-methylphenyl]-1-methylpiperazine-2-carboxylic acid |
| SMILES | Cc1ccc(CN2CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC2)c(N2CCN(C)C(C(=O)O)C2)c1 |
| InChI | InChI=1S/C22H28F6N4O4/c1-14-3-4-15(16(11-14)32-8-5-29(2)17(13-32)18(33)34)12-30-6-9-31(10-7-30)20(35)36-19(21(23,24)25)22(26,27)28/h3-4,11,17,19H,5-10,12-13H2,1-2H3,(H,33,34) |
| InChIKey | UDIKHHKBQGJSFZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 76.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |