C19H23F6N3O4 — CID 134507789
3-[2-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-5-methylanilino]propanoic acid (PubChem CID 134507789) has the molecular formula C19H23F6N3O4 and a molecular weight of 471.40 g/mol. Its IUPAC name is 3-[2-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-5-methylanilino]propanoic acid.
| Compound Name | 3-[2-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-5-methylanilino]propanoic acid |
|---|---|
| PubChem CID | 134507789 |
| Molecular Formula | C19H23F6N3O4 |
| Molecular Weight | 471.40 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | 3-[2-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-5-methylanilino]propanoic acid |
| SMILES | Cc1ccc(CN2CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC2)c(NCCC(=O)O)c1 |
| InChI | InChI=1S/C19H23F6N3O4/c1-12-2-3-13(14(10-12)26-5-4-15(29)30)11-27-6-8-28(9-7-27)17(31)32-16(18(20,21)22)19(23,24)25/h2-3,10,16,26H,4-9,11H2,1H3,(H,29,30) |
| InChIKey | FVMGRLRAXUSJIT-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |