C22H27F7N2O4 — CID 167004673
4-[2-fluoro-6-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-3-methylphenyl]-2,2-dimethylbutanoic acid (PubChem CID 167004673) has the molecular formula C22H27F7N2O4 and a molecular weight of 516.45 g/mol. Its IUPAC name is 4-[2-fluoro-6-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-3-methylphenyl]-2,2-dimethylbutanoic acid.
| Compound Name | 4-[2-fluoro-6-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-3-methylphenyl]-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 167004673 |
| Molecular Formula | C22H27F7N2O4 |
| Molecular Weight | 516.45 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | 4-[2-fluoro-6-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-3-methylphenyl]-2,2-dimethylbutanoic acid |
| SMILES | Cc1ccc(CN2CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC2)c(CCC(C)(C)C(=O)O)c1F |
| InChI | InChI=1S/C22H27F7N2O4/c1-13-4-5-14(15(16(13)23)6-7-20(2,3)18(32)33)12-30-8-10-31(11-9-30)19(34)35-17(21(24,25)26)22(27,28)29/h4-5,17H,6-12H2,1-3H3,(H,32,33) |
| InChIKey | VHQQCTTZLJFISA-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.45 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |