C19H22F7N3O6S — CID 134496407
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[3-fluoro-2-[2-(methanesulfonamido)-2-oxoethoxy]-4-methylphenyl]methyl]piperazine-1-carboxylate (PubChem CID 134496407) has the molecular formula C19H22F7N3O6S and a molecular weight of 553.45 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[3-fluoro-2-[2-(methanesulfonamido)-2-oxoethoxy]-4-methylphenyl]methyl]piperazine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[3-fluoro-2-[2-(methanesulfonamido)-2-oxoethoxy]-4-methylphenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 134496407 |
| Molecular Formula | C19H22F7N3O6S |
| Molecular Weight | 553.45 g/mol |
| Exact Mass | 553.11 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[3-fluoro-2-[2-(methanesulfonamido)-2-oxoethoxy]-4-methylphenyl]methyl]piperazine-1-carboxylate |
| SMILES | Cc1ccc(CN2CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC2)c(OCC(=O)NS(C)(=O)=O)c1F |
| InChI | InChI=1S/C19H22F7N3O6S/c1-11-3-4-12(15(14(11)20)34-10-13(30)27-36(2,32)33)9-28-5-7-29(8-6-28)17(31)35-16(18(21,22)23)19(24,25)26/h3-4,16H,5-10H2,1-2H3,(H,27,30) |
| InChIKey | LTPLDADXDHQQNG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.45 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |