C22H26ClF6N3O6S — CID 134496299
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[3-chloro-4-methyl-2-[[1-(methylsulfonylcarbamoyl)cyclopropyl]methoxy]phenyl]methyl]piperazine-1-carboxylate (PubChem CID 134496299) has the molecular formula C22H26ClF6N3O6S and a molecular weight of 609.97 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[3-chloro-4-methyl-2-[[1-(methylsulfonylcarbamoyl)cyclopropyl]methoxy]phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[3-chloro-4-methyl-2-[[1-(methylsulfonylcarbamoyl)cyclopropyl]methoxy]phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 134496299 |
| Molecular Formula | C22H26ClF6N3O6S |
| Molecular Weight | 609.97 g/mol |
| Exact Mass | 609.11 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[3-chloro-4-methyl-2-[[1-(methylsulfonylcarbamoyl)cyclopropyl]methoxy]phenyl]methyl]piperazine-1-carboxylate |
| SMILES | Cc1ccc(CN2CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC2)c(OCC2(C(=O)NS(C)(=O)=O)CC2)c1Cl |
| InChI | InChI=1S/C22H26ClF6N3O6S/c1-13-3-4-14(16(15(13)23)37-12-20(5-6-20)18(33)30-39(2,35)36)11-31-7-9-32(10-8-31)19(34)38-17(21(24,25)26)22(27,28)29/h3-4,17H,5-12H2,1-2H3,(H,30,33) |
| InChIKey | CWFJDKRRHKEMPI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.97 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |