C15H16F6N2O2 — CID 118098574
1,1,1,3,3,3-hexafluoropropan-2-yl 4-benzylpiperazine-1-carboxylate (PubChem CID 118098574) has the molecular formula C15H16F6N2O2 and a molecular weight of 370.29 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-benzylpiperazine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-benzylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 118098574 |
| Molecular Formula | C15H16F6N2O2 |
| Molecular Weight | 370.29 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-benzylpiperazine-1-carboxylate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C15H16F6N2O2/c16-14(17,18)12(15(19,20)21)25-13(24)23-8-6-22(7-9-23)10-11-4-2-1-3-5-11/h1-5,12H,6-10H2 |
| InChIKey | ZURNYTGUSMYPSN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.29 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |