C19H22F6N2O2 — CID 166650238
1,1,1,3,3,3-hexafluoropropan-2-yl 2-benzyl-2,8-diazaspiro[4.5]decane-8-carboxylate (PubChem CID 166650238) has the molecular formula C19H22F6N2O2 and a molecular weight of 424.39 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 2-benzyl-2,8-diazaspiro[4.5]decane-8-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-benzyl-2,8-diazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 166650238 |
| Molecular Formula | C19H22F6N2O2 |
| Molecular Weight | 424.39 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-benzyl-2,8-diazaspiro[4.5]decane-8-carboxylate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)N1CCC2(CCN(Cc3ccccc3)C2)CC1 |
| InChI | InChI=1S/C19H22F6N2O2/c20-18(21,22)15(19(23,24)25)29-16(28)27-10-7-17(8-11-27)6-9-26(13-17)12-14-4-2-1-3-5-14/h1-5,15H,6-13H2 |
| InChIKey | FHDJSCUOEGJWKO-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |