C16H17F6NO2 — CID 89480931
1,1,1,3,3,3-hexafluoropropan-2-yl 4-benzylpiperidine-1-carboxylate (PubChem CID 89480931) has the molecular formula C16H17F6NO2 and a molecular weight of 369.31 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-benzylpiperidine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-benzylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 89480931 |
| Molecular Formula | C16H17F6NO2 |
| Molecular Weight | 369.31 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-benzylpiperidine-1-carboxylate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C16H17F6NO2/c17-15(18,19)13(16(20,21)22)25-14(24)23-8-6-12(7-9-23)10-11-4-2-1-3-5-11/h1-5,12-13H,6-10H2 |
| InChIKey | MWWNGOGZSYMETP-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.31 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |