C17H17F9N2O4S — CID 89483571
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[[2-(trifluoromethyl)phenyl]sulfonylamino]methyl]piperidine-1-carboxylate (PubChem CID 89483571) has the molecular formula C17H17F9N2O4S and a molecular weight of 516.38 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[[2-(trifluoromethyl)phenyl]sulfonylamino]methyl]piperidine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[[2-(trifluoromethyl)phenyl]sulfonylamino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 89483571 |
| Molecular Formula | C17H17F9N2O4S |
| Molecular Weight | 516.38 g/mol |
| Exact Mass | 516.08 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[[2-(trifluoromethyl)phenyl]sulfonylamino]methyl]piperidine-1-carboxylate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)N1CCC(CNS(=O)(=O)c2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C17H17F9N2O4S/c18-15(19,20)11-3-1-2-4-12(11)33(30,31)27-9-10-5-7-28(8-6-10)14(29)32-13(16(21,22)23)17(24,25)26/h1-4,10,13,27H,5-9H2 |
| InChIKey | CTDYEEOTJAKIOE-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.38 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |