C18H21F6N3O5S — CID 89480758
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[2-[(4-sulfamoylbenzoyl)amino]ethyl]piperidine-1-carboxylate (PubChem CID 89480758) has the molecular formula C18H21F6N3O5S and a molecular weight of 505.44 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[2-[(4-sulfamoylbenzoyl)amino]ethyl]piperidine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[2-[(4-sulfamoylbenzoyl)amino]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 89480758 |
| Molecular Formula | C18H21F6N3O5S |
| Molecular Weight | 505.44 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[2-[(4-sulfamoylbenzoyl)amino]ethyl]piperidine-1-carboxylate |
| SMILES | NS(=O)(=O)c1ccc(C(=O)NCCC2CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C18H21F6N3O5S/c19-17(20,21)15(18(22,23)24)32-16(29)27-9-6-11(7-10-27)5-8-26-14(28)12-1-3-13(4-2-12)33(25,30)31/h1-4,11,15H,5-10H2,(H,26,28)(H2,25,30,31) |
| InChIKey | KLZYDCPPUHHNQA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.44 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |