C12H16N2O3S — CID 43298916
N-(cyclobutylmethyl)-4-sulfamoylbenzamide (PubChem CID 43298916) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is N-(cyclobutylmethyl)-4-sulfamoylbenzamide.
| Compound Name | N-(cyclobutylmethyl)-4-sulfamoylbenzamide |
|---|---|
| PubChem CID | 43298916 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | N-(cyclobutylmethyl)-4-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1ccc(C(=O)NCC2CCC2)cc1 |
| InChI | InChI=1S/C12H16N2O3S/c13-18(16,17)11-6-4-10(5-7-11)12(15)14-8-9-2-1-3-9/h4-7,9H,1-3,8H2,(H,14,15)(H2,13,16,17) |
| InChIKey | USQKUHUBIAZNOD-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |