C20H30N2O3S — CID 2666739
4-(azepan-1-ylsulfonyl)-N-(cyclohexylmethyl)benzamide (PubChem CID 2666739) has the molecular formula C20H30N2O3S and a molecular weight of 378.54 g/mol. Its IUPAC name is 4-(azepan-1-ylsulfonyl)-N-(cyclohexylmethyl)benzamide.
| Compound Name | 4-(azepan-1-ylsulfonyl)-N-(cyclohexylmethyl)benzamide |
|---|---|
| PubChem CID | 2666739 |
| Molecular Formula | C20H30N2O3S |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 4-(azepan-1-ylsulfonyl)-N-(cyclohexylmethyl)benzamide |
| SMILES | O=C(NCC1CCCCC1)c1ccc(S(=O)(=O)N2CCCCCC2)cc1 |
| InChI | InChI=1S/C20H30N2O3S/c23-20(21-16-17-8-4-3-5-9-17)18-10-12-19(13-11-18)26(24,25)22-14-6-1-2-7-15-22/h10-13,17H,1-9,14-16H2,(H,21,23) |
| InChIKey | ICQKWJKXAPBVPV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |