C18H22F6N2O6S — CID 89480803
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[(2,5-dimethoxyphenyl)sulfonylamino]methyl]piperidine-1-carboxylate (PubChem CID 89480803) has the molecular formula C18H22F6N2O6S and a molecular weight of 508.44 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[(2,5-dimethoxyphenyl)sulfonylamino]methyl]piperidine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[(2,5-dimethoxyphenyl)sulfonylamino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 89480803 |
| Molecular Formula | C18H22F6N2O6S |
| Molecular Weight | 508.44 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[(2,5-dimethoxyphenyl)sulfonylamino]methyl]piperidine-1-carboxylate |
| SMILES | COc1ccc(OC)c(S(=O)(=O)NCC2CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC2)c1 |
| InChI | InChI=1S/C18H22F6N2O6S/c1-30-12-3-4-13(31-2)14(9-12)33(28,29)25-10-11-5-7-26(8-6-11)16(27)32-15(17(19,20)21)18(22,23)24/h3-4,9,11,15,25H,5-8,10H2,1-2H3 |
| InChIKey | LRTLNSFVNRTAKL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |