C16H24N2O6S — CID 32944673
ethyl 4-[(2,5-dimethoxyphenyl)sulfonylamino]piperidine-1-carboxylate (PubChem CID 32944673) has the molecular formula C16H24N2O6S and a molecular weight of 372.44 g/mol. Its IUPAC name is ethyl 4-[(2,5-dimethoxyphenyl)sulfonylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(2,5-dimethoxyphenyl)sulfonylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 32944673 |
| Molecular Formula | C16H24N2O6S |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | ethyl 4-[(2,5-dimethoxyphenyl)sulfonylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NS(=O)(=O)c2cc(OC)ccc2OC)CC1 |
| InChI | InChI=1S/C16H24N2O6S/c1-4-24-16(19)18-9-7-12(8-10-18)17-25(20,21)15-11-13(22-2)5-6-14(15)23-3/h5-6,11-12,17H,4,7-10H2,1-3H3 |
| InChIKey | GENSMFQFTNRWRR-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |