C19H30N2O4S — CID 30923060
ethyl 4-[(5-tert-butyl-2-methylphenyl)sulfonylamino]piperidine-1-carboxylate (PubChem CID 30923060) has the molecular formula C19H30N2O4S and a molecular weight of 382.53 g/mol. Its IUPAC name is ethyl 4-[(5-tert-butyl-2-methylphenyl)sulfonylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(5-tert-butyl-2-methylphenyl)sulfonylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 30923060 |
| Molecular Formula | C19H30N2O4S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | ethyl 4-[(5-tert-butyl-2-methylphenyl)sulfonylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NS(=O)(=O)c2cc(C(C)(C)C)ccc2C)CC1 |
| InChI | InChI=1S/C19H30N2O4S/c1-6-25-18(22)21-11-9-16(10-12-21)20-26(23,24)17-13-15(19(3,4)5)8-7-14(17)2/h7-8,13,16,20H,6,9-12H2,1-5H3 |
| InChIKey | NNYAQUYSFIXNRV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |