C14H19BrN2O4S — CID 26945526
ethyl 4-[(4-bromophenyl)sulfonylamino]piperidine-1-carboxylate (PubChem CID 26945526) has the molecular formula C14H19BrN2O4S and a molecular weight of 391.29 g/mol. Its IUPAC name is ethyl 4-[(4-bromophenyl)sulfonylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(4-bromophenyl)sulfonylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 26945526 |
| Molecular Formula | C14H19BrN2O4S |
| Molecular Weight | 391.29 g/mol |
| Exact Mass | 390.02 |
| IUPAC Name | ethyl 4-[(4-bromophenyl)sulfonylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NS(=O)(=O)c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C14H19BrN2O4S/c1-2-21-14(18)17-9-7-12(8-10-17)16-22(19,20)13-5-3-11(15)4-6-13/h3-6,12,16H,2,7-10H2,1H3 |
| InChIKey | XSROGDJMXBWVQY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |