C26H34N2O5S — CID 43002482
ethyl 1-[4-[(5-tert-butyl-2-methylphenyl)sulfonylamino]benzoyl]piperidine-4-carboxylate (PubChem CID 43002482) has the molecular formula C26H34N2O5S and a molecular weight of 486.63 g/mol. Its IUPAC name is ethyl 1-[4-[(5-tert-butyl-2-methylphenyl)sulfonylamino]benzoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[4-[(5-tert-butyl-2-methylphenyl)sulfonylamino]benzoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 43002482 |
| Molecular Formula | C26H34N2O5S |
| Molecular Weight | 486.63 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | ethyl 1-[4-[(5-tert-butyl-2-methylphenyl)sulfonylamino]benzoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)c2ccc(NS(=O)(=O)c3cc(C(C)(C)C)ccc3C)cc2)CC1 |
| InChI | InChI=1S/C26H34N2O5S/c1-6-33-25(30)20-13-15-28(16-14-20)24(29)19-8-11-22(12-9-19)27-34(31,32)23-17-21(26(3,4)5)10-7-18(23)2/h7-12,17,20,27H,6,13-16H2,1-5H3 |
| InChIKey | MHKACKGCKFSLMZ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.63 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |