C19H29NO4S — CID 3905235
ethyl 1-(5-tert-butyl-2-methylphenyl)sulfonylpiperidine-3-carboxylate (PubChem CID 3905235) has the molecular formula C19H29NO4S and a molecular weight of 367.51 g/mol. Its IUPAC name is ethyl 1-(5-tert-butyl-2-methylphenyl)sulfonylpiperidine-3-carboxylate.
| Compound Name | ethyl 1-(5-tert-butyl-2-methylphenyl)sulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 3905235 |
| Molecular Formula | C19H29NO4S |
| Molecular Weight | 367.51 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | ethyl 1-(5-tert-butyl-2-methylphenyl)sulfonylpiperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(S(=O)(=O)c2cc(C(C)(C)C)ccc2C)C1 |
| InChI | InChI=1S/C19H29NO4S/c1-6-24-18(21)15-8-7-11-20(13-15)25(22,23)17-12-16(19(3,4)5)10-9-14(17)2/h9-10,12,15H,6-8,11,13H2,1-5H3 |
| InChIKey | ACJQAHFQTMJCTH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.51 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |