C14H17Br2NO4S — CID 26948371
ethyl (3R)-1-(2,5-dibromophenyl)sulfonylpiperidine-3-carboxylate (PubChem CID 26948371) has the molecular formula C14H17Br2NO4S and a molecular weight of 455.17 g/mol. Its IUPAC name is ethyl (3R)-1-(2,5-dibromophenyl)sulfonylpiperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-(2,5-dibromophenyl)sulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 26948371 |
| Molecular Formula | C14H17Br2NO4S |
| Molecular Weight | 455.17 g/mol |
| Exact Mass | 452.92 |
| IUPAC Name | ethyl (3R)-1-(2,5-dibromophenyl)sulfonylpiperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(S(=O)(=O)c2cc(Br)ccc2Br)C1 |
| InChI | InChI=1S/C14H17Br2NO4S/c1-2-21-14(18)10-4-3-7-17(9-10)22(19,20)13-8-11(15)5-6-12(13)16/h5-6,8,10H,2-4,7,9H2,1H3/t10-/m1/s1 |
| InChIKey | JWMSNXBAYNZJRF-SNVBAGLBSA-N |
| XLogP | 3.18 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.17 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |